| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:47 UTC |
|---|
| Update Date | 2025-03-21 18:00:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026152 |
|---|
| Frequency | 146.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O6S |
|---|
| Molecular Mass | 234.0198 |
|---|
| SMILES | O=S(=O)(O)OCCc1ccc(O)c(O)c1 |
|---|
| InChI Key | BYXGMCQTVHBBRR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl sulfatesbenzene and substituted derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundssulfuric acid monoesters |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoesterorganic sulfuric acid or derivatives1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxideorganic oxygen compoundalkyl sulfatesulfate-esterhydrocarbon derivativetyrosol derivativesulfuric acid esterorganooxygen compound |
|---|
