| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:47 UTC |
|---|
| Update Date | 2025-03-21 18:00:15 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026165 |
|---|
| Frequency | 181.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H13N5O3 |
|---|
| Molecular Mass | 215.1018 |
|---|
| SMILES | N=C(N)NC(=N)NCCCC(=O)C(=O)O |
|---|
| InChI Key | HQEYHSNVAGOJLE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | guanidines |
|---|
| Direct Parent | biguanides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativescarboximidamidescarboxylic acidshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsshort-chain keto acids and derivatives |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidimineshort-chain keto acidcarboximidamidealpha-hydroxy ketonecarboxylic acid derivativeketoneorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundketo acidalpha-keto acidorganopnictogen compoundhydrocarbon derivativebiguanideorganooxygen compound |
|---|
