Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:44:48 UTC |
---|
Update Date | 2025-03-21 18:00:16 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00026184 |
---|
Frequency | 146.4 |
---|
Structure | |
---|
Chemical Formula | C12H16O9S |
---|
Molecular Mass | 336.0515 |
---|
SMILES | O=C(CCC(O)Cc1cc(O)ccc1O)OCOS(=O)(=O)O |
---|
InChI Key | LVRQSPGNAKBCEN-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | phenols |
---|
Subclass | benzenediols |
---|
Direct Parent | hydroquinones |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl sulfatesbenzene and substituted derivativescarbonyl compoundscarboxylic acid estersfatty acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcoholssulfuric acid monoesters |
---|
Substituents | alcoholfatty acylmonocyclic benzene moietysulfuric acid monoestercarbonyl grouporganic sulfuric acid or derivatives1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativehydroquinonearomatic homomonocyclic compoundfatty acid esterorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundcarboxylic acid esteralkyl sulfatesecondary alcoholsulfate-esterhydrocarbon derivativesulfuric acid esterorganooxygen compound |
---|