| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:44:49 UTC |
|---|
| Update Date | 2025-03-21 18:00:17 UTC |
|---|
| HMDB ID | HMDB0002200 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026255 |
|---|
| Name | Leukotriene E4 |
|---|
| Frequency | 146.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H37NO5S |
|---|
| Molecular Mass | 439.2392 |
|---|
| SMILES | CCCCCC=CCC=CC=CC=CC(SCC(N)C(=O)O)C(O)CCCC(=O)O |
|---|
| InChI Key | OTZRAYGBFWZKMX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | long-chain fatty acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdialkylthioethersdicarboxylic acids and derivativesfatty acylshydrocarbon derivativeshydroxy fatty acidsmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssulfenyl compoundsthia fatty acids |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl grouplong-chain fatty acidcarboxylic acidalpha-amino acid or derivativesorganosulfur compoundcarboxylic acid derivativeorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundhydroxy fatty acidalcoholsulfenyl compounddialkylthioetherthia fatty acidorganic oxygen compoundthioethercysteine or derivativessecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|
