| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:50 UTC |
|---|
| Update Date | 2025-03-21 18:00:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026275 |
|---|
| Frequency | 145.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H24ClNO10 |
|---|
| Molecular Mass | 401.1089 |
|---|
| SMILES | CC(=O)NC1C(O)OC(CO)C(OC2OC(CO)C(Cl)C(O)C2O)C1O |
|---|
| InChI Key | XGRWVPIFYXNQQZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | acylaminosugars |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesalkyl chloridescarbonyl compoundscarboxylic acids and derivativeschlorohydrinshemiacetalshydrocarbon derivativesmonosaccharidesn-acyl-alpha-hexosaminesorganic oxidesorganochloridesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl groupchlorohydrinalkyl chlorideorganochloridemonosaccharidecarboxylic acid derivativeorganohalogen compoundn-acyl-alpha-hexosamineorganic oxideacetalaliphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetalalkyl halideoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholhalohydrincarboxamide groupacylaminosugaroxacyclesecondary carboxylic acid amidesecondary alcoholhydrocarbon derivativeorganic nitrogen compound |
|---|
