| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:51 UTC |
|---|
| Update Date | 2025-03-21 18:00:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026317 |
|---|
| Frequency | 145.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O6 |
|---|
| Molecular Mass | 286.0477 |
|---|
| SMILES | O=c1c2coc3c1C=CC(O)=C(O)C2=CC=C(O)C(O)=C3 |
|---|
| InChI Key | GYZGLURXXCRKMY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | pyranones and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | heteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | oxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundheteroaromatic compoundpyranonehydrocarbon derivativeorganooxygen compound |
|---|
