| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:44:52 UTC |
|---|
| Update Date | 2025-03-21 18:00:17 UTC |
|---|
| HMDB ID | HMDB0130362 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026342 |
|---|
| Name | 3-(3,4-dimethoxyphenyl)-7-hydroxy-4H-chromen-4-one |
|---|
| Frequency | 145.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H14O5 |
|---|
| Molecular Mass | 298.0841 |
|---|
| SMILES | COc1ccc(-c2coc3cc(O)ccc3c2=O)cc1OC |
|---|
| InChI Key | VFZIJLPRJAQGFO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisoleschromonesdimethoxybenzenesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesoxacyclic compoundsphenoxy compoundspyranones and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether1-benzopyran1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherdimethoxybenzeneorganic oxidechromonearomatic heteropolycyclic compoundo-dimethoxybenzenepyranoneorganoheterocyclic compoundisoflavonebenzopyranheteroaromatic compoundmethoxybenzeneoxacycleorganic oxygen compoundpyrananisolehydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
