| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:44:53 UTC |
|---|
| Update Date | 2025-03-21 18:00:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026377 |
|---|
| Frequency | 145.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H24N2O8 |
|---|
| Molecular Mass | 396.1533 |
|---|
| SMILES | CC(=O)N1CCN(c2ccc(OC3OC(C(=O)O)C(O)C(O)C3O)cc2)CC1 |
|---|
| InChI Key | YOFUHNACRPYENI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsacetamidesamino acidsaniline and substituted anilinesazacyclic compoundsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdialkylarylaminesglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-arylpiperazinesorganic oxidesorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundsphenylpiperazinespyran carboxylic acidssecondary alcoholstertiary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundamino acid or derivativesamino acido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalpiperazinetertiary aliphatic/aromatic aminetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundoxanedialkylarylaminetertiary amineorganoheterocyclic compoundacetamidealcoholpyran carboxylic acid or derivativesazacycleaniline or substituted anilineshydroxy acidcarboxamide groupphenylpiperazineoxacyclemonocarboxylic acid or derivativespyran1,4-diazinanesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundaminen-arylpiperazine |
|---|