Record Information |
---|
HMDB Status | quantified |
---|
Creation Date | 2024-02-20 23:44:53 UTC |
---|
Update Date | 2025-03-21 18:00:18 UTC |
---|
HMDB ID | HMDB0000631 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00026400 |
---|
Name | Deoxycholic acid glycine conjugate |
---|
Frequency | 145.0 |
---|
Structure | |
---|
Chemical Formula | C26H43NO5 |
---|
Molecular Mass | 449.3141 |
---|
SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C |
---|
InChI Key | WVULKSPCQVQLCU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | lipids and lipid-like molecules |
---|
Class | steroids and steroid derivatives |
---|
Subclass | bile acids, alcohols and derivatives |
---|
Direct Parent | bile acids, alcohols and derivatives |
---|
Geometric Descriptor | aliphatic homopolycyclic compounds |
---|
Alternative Parents | 12-hydroxysteroids3-hydroxysteroidsacyl glycinesalpha amino acidscarbonyl compoundscarboxylic acidscyclic alcohols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesn-acyl aminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcoholssecondary carboxylic acid amides |
---|
Substituents | fatty acylcarbonyl group12-hydroxysteroidcarboxylic acidfatty amidealpha-amino acid or derivativescarboxylic acid derivativebile acid, alcohol, or derivativesaliphatic homopolycyclic compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundn-acyl-alpha amino acid or derivativesalcoholn-acyl-alpha-amino acid3-hydroxysteroidhydroxysteroidcyclic alcoholcarboxamide groupn-acyl-aminen-acylglycinesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
---|