| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:45:00 UTC |
|---|
| Update Date | 2025-03-21 18:00:21 UTC |
|---|
| HMDB ID | HMDB0140967 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026689 |
|---|
| Name | 3-hydroxy-2-[4-(2-methylpropyl)phenyl]propanoic acid |
|---|
| Frequency | 143.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H18O3 |
|---|
| Molecular Mass | 222.1256 |
|---|
| SMILES | CC(C)Cc1ccc(C(CO)C(=O)O)cc1 |
|---|
| InChI Key | GSVPDLNMVPXACN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | aromatic monoterpenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsorganic oxidesphenylpropanesprimary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidcarboxylic acidp-cymenehydroxy acidcarboxylic acid derivativephenylpropanearomatic homomonocyclic compoundbeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidprimary alcoholorganooxygen compoundaromatic monoterpenoid |
|---|
