| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:01 UTC |
|---|
| Update Date | 2025-03-21 18:00:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026707 |
|---|
| Frequency | 142.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H12O2 |
|---|
| Molecular Mass | 212.0837 |
|---|
| SMILES | Oc1ccc2c(c1)CCc1ccc(O)cc1-2 |
|---|
| InChI Key | JZKXCYZTAGMLRB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidshydrocarbon derivativesnaphthols and derivativesorganooxygen compounds |
|---|
| Substituents | phenanthrenenaphthaleneorganic oxygen compound1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compoundhydrocarbon derivative2-naphtholorganooxygen compound |
|---|
