| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:02 UTC |
|---|
| Update Date | 2025-03-21 18:00:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026732 |
|---|
| Frequency | 142.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H2Cl3NO3 |
|---|
| Molecular Mass | 264.91 |
|---|
| SMILES | N#Cc1c(Cl)c(Cl)c(O)c(C(=O)O)c1Cl |
|---|
| InChI Key | YHSYZVXHMZFNIU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds2-halobenzoic acids3-halobenzoic acids4-halobenzoic acidsaryl chloridesbenzoic acidsbenzonitrilesbenzoyl derivativeschlorobenzeneshalobenzoic acidshalophenolshydrocarbon derivativesm-chlorophenolsmonocarboxylic acids and derivativesnitrileso-chlorophenolsorganic oxidesorganochloridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsvinylogous acidsvinylogous halides |
|---|
| Substituents | 2-halobenzoic acidnitrilecarboxylic acid3-halobenzoic acid or derivativesorganochloridebenzoylsalicylic acidcarboxylic acid derivativeorganohalogen compoundorganic oxide3-halobenzoic acidorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidcarbonitrilearyl chloride2-chlorophenolchlorobenzene3-halophenol3-chlorophenolhalobenzoic acid4-halobenzoic acidhalobenzoic acid or derivativesvinylogous halide2-halobenzoic acid or derivativesbenzonitrilearyl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compound2-halophenolvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
