| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:04 UTC |
|---|
| Update Date | 2025-03-21 18:00:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026840 |
|---|
| Frequency | 142.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10N5O6P |
|---|
| Molecular Mass | 315.0369 |
|---|
| SMILES | Nc1nc2c(ncn2C2OC3COP(=O)(O)OC32)c(=O)[nH]1 |
|---|
| InChI Key | FLTQXGGJDSULHN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | imidazopyrimidines |
|---|
| Subclass | purines and purine derivatives |
|---|
| Direct Parent | hypoxanthines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidazoleslactamsn-substituted imidazolesorganic oxidesorganic phosphoric acids and derivativesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundsoxetanesprimary aminespurines and purine derivativespyrimidonesvinylogous amides |
|---|
| Substituents | lactampyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundimidazoleorganonitrogen compoundorganopnictogen compoundazolen-substituted imidazolevinylogous amideazacycleheteroaromatic compoundoxacycleorganic oxygen compoundoxetanehypoxanthinehydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|