| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:04 UTC |
|---|
| Update Date | 2025-03-21 18:00:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026841 |
|---|
| Frequency | 142.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H8O4 |
|---|
| Molecular Mass | 204.0423 |
|---|
| SMILES | O=C(O)c1ccc(-c2ccc(O)cc2)o1 |
|---|
| InChI Key | VBAXFEBFJQEKKY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsbenzene and substituted derivativescarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidaromatic heteromonocyclic compoundheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativefuroic acidoxacycleorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
