| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:07 UTC |
|---|
| Update Date | 2025-03-21 18:00:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00026935 |
|---|
| Frequency | 141.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H12O3 |
|---|
| Molecular Mass | 216.0786 |
|---|
| SMILES | O=C(O)C(O)Cc1cccc2ccccc12 |
|---|
| InChI Key | OLGKAGFGKUUJIO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenes |
|---|
| Direct Parent | naphthalenes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alpha hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarboxylic acidalpha-hydroxy acidaromatic homopolycyclic compoundhydroxy acidcarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganooxygen compound |
|---|
