| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:14 UTC |
|---|
| Update Date | 2025-03-21 18:00:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00027190 |
|---|
| Frequency | 139.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N2O3 |
|---|
| Molecular Mass | 224.1161 |
|---|
| SMILES | NCC(O)COc1ccc(CC(N)=O)cc1 |
|---|
| InChI Key | UWMXVJVTKRSOPW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl etherscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsprimary carboxylic acid amidessecondary alcohols |
|---|
| Substituents | primary carboxylic acid amidealcoholphenol ethercarbonyl groupetheralkyl aryl ethercarboxamide groupcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundphenoxy compoundphenylacetamideorganooxygen compound |
|---|
