Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:45:15 UTC |
---|
Update Date | 2025-03-21 18:00:26 UTC |
---|
HMDB ID | HMDB0129406 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00027247 |
---|
Name | 6-(2H-1,3-benzodioxol-5-yloxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
---|
Frequency | 139.5 |
---|
Structure | |
---|
Chemical Formula | C13H14O9 |
---|
Molecular Mass | 314.0638 |
---|
SMILES | O=C(O)C1OC(Oc2ccc3c(c2)OCO3)C(O)C(O)C1O |
---|
InChI Key | LQHCPUWEYPHYDK-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic oxygen compounds |
---|
Class | organooxygen compounds |
---|
Subclass | carbohydrates and carbohydrate conjugates |
---|
Direct Parent | o-glucuronides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | acetalsbenzodioxolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyran carboxylic acidssecondary alcohols |
---|
Substituents | phenol ethercarbonyl groupcarboxylic acido-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetalaromatic heteropolycyclic compoundoxaneorganoheterocyclic compoundbenzodioxolealcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoid |
---|