| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:19 UTC |
|---|
| Update Date | 2025-03-21 18:00:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00027382 |
|---|
| Frequency | 138.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N3O7P |
|---|
| Molecular Mass | 305.0413 |
|---|
| SMILES | Nc1ccn(C2C(O)C(O)C3OP(=O)(O)OC32)c(=O)n1 |
|---|
| InChI Key | FMPSPCZXKHBLAR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | nucleoside and nucleotide analogues |
|---|
| Subclass | cyclopentyl nucleosides |
|---|
| Direct Parent | cyclopentyl nucleosides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsazacyclic compoundscyclic alcohols and derivativesdioxaphospholanesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganic phosphoric acids and derivativesorganopnictogen compoundsoxacyclic compoundsprimary aminespyrimidonessecondary alcohols |
|---|
| Substituents | pyrimidonepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundimidolactamorganoheterocyclic compound1,2-diolcyclopentyl nucleosidealcoholcarbonic acid derivativeazacycleheteroaromatic compound1,3_dioxaphospholanecyclic alcoholoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeamineorganooxygen compound |
|---|
