| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:23 UTC |
|---|
| Update Date | 2025-03-21 18:00:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00027578 |
|---|
| Frequency | 137.4 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H9FO3 |
|---|
| Molecular Mass | 256.0536 |
|---|
| SMILES | O=c1c(-c2ccc(F)cc2)coc2cc(O)ccc12 |
|---|
| InChI Key | QSPKURPSCTYUBO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | isoflavonoids |
|---|
| Subclass | isoflav-2-enes |
|---|
| Direct Parent | isoflavones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl fluorideschromonesfluorobenzenesheteroaromatic compoundshydrocarbon derivativesisoflavonoidsorganic oxidesorganofluoridesorganooxygen compoundsoxacyclic compoundspyranones and derivatives |
|---|
| Substituents | aryl fluoridemonocyclic benzene moiety1-benzopyran1-hydroxy-2-unsubstituted benzenoidorganohalogen compoundfluorobenzeneorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundisoflavonebenzopyranorganofluorideheteroaromatic compoundaryl halideoxacycleorganic oxygen compoundpyranhydrocarbon derivativebenzenoidhalobenzeneorganooxygen compound |
|---|
