| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:24 UTC |
|---|
| Update Date | 2025-03-21 18:00:29 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00027606 |
|---|
| Frequency | 137.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N2O4S |
|---|
| Molecular Mass | 244.0518 |
|---|
| SMILES | O=C1NC2CSC(CCC(=O)C(=O)O)C2N1 |
|---|
| InChI Key | JOMWAUUFBIIXIG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | thienoimidazolidines |
|---|
| Subclass | thienoimidazolidines |
|---|
| Direct Parent | thienoimidazolidines |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | alpha-hydroxy ketonesalpha-keto acids and derivativesazacyclic compoundscarboxylic acidsdialkylthioethersfatty acylsheterocyclic fatty acidshydrocarbon derivativesimidazolidinonesmonocarboxylic acids and derivativesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsshort-chain keto acids and derivativesthiolanesthiophenes |
|---|
| Substituents | thiolaneimidazolidinefatty acylcarbonyl groupcarboxylic acidheterocyclic fatty acidshort-chain keto acidthiophenealpha-hydroxy ketonecarboxylic acid derivativeketonealiphatic heteropolycyclic compoundimidazolidinoneorganic oxideorganonitrogen compoundalpha-keto acidorganopnictogen compoundcarbonic acid derivativeazacycledialkylthioetherthienoimidazolidinemonocarboxylic acid or derivativesorganic oxygen compoundthioetherketo acidhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
