DeepMet

Record Information
HMDB Status	Not Available
Creation Date	2024-02-20 23:45:31 UTC
Update Date	2025-03-21 18:00:32 UTC
HMDB ID	Not Available
Metabolite Identification
DeepMet ID	DMID00027883
Frequency	135.6
Structure
Chemical Formula	C₁₃H₁₂ClN₃O₄S
Molecular Mass	341.0237
SMILES	NS(=O)(=O)c1cc(C(=O)O)c(NCc2cccnc2)cc1Cl
InChI Key	VNJMWCGTFGSIMT-UHFFFAOYSA-N
Chemical Taxonomy
Kingdom	organic compounds
Superclass	benzenoids
Class	benzene and substituted derivatives
Subclass	benzenesulfonamides
Direct Parent	benzenesulfonamides
Geometric Descriptor	aromatic heteromonocyclic compounds
Alternative Parents	1-carboxy-2-haloaromatic compounds 4-halobenzoic acids amino acids aminosulfonyl compounds aryl chlorides azacyclic compounds benzenesulfonyl compounds benzoic acids benzoyl derivatives chlorobenzenes halobenzoic acids heteroaromatic compounds hydrocarbon derivatives hydroxypyridines monocarboxylic acids and derivatives organic oxides organochlorides organooxygen compounds organopnictogen compounds organosulfonamides phenylalkylamines secondary alkylarylamines vinylogous amides
Substituents	organosulfonic acid or derivatives carboxylic acid aromatic heteromonocyclic compound amino acid or derivatives amino acid organochloride benzoyl organosulfur compound carboxylic acid derivative organohalogen compound organosulfonic acid amide organic oxide organonitrogen compound organopnictogen compound 1-carboxy-2-haloaromatic compound benzoic acid organoheterocyclic compound benzenesulfonyl group aryl chloride chlorobenzene vinylogous amide halobenzoic acid benzenesulfonamide 4-halobenzoic acid azacycle aminosulfonyl compound heteroaromatic compound hydroxypyridine benzoic acid or derivatives halobenzoic acid or derivatives secondary amine secondary aliphatic/aromatic amine aryl halide 4-halobenzoic acid or derivatives monocarboxylic acid or derivatives sulfonyl pyridine organic oxygen compound organic sulfonic acid or derivatives phenylalkylamine hydrocarbon derivative organic nitrogen compound halobenzene amine organooxygen compound

Showing information for DMID00027883