| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:32 UTC |
|---|
| Update Date | 2025-03-21 18:00:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00027907 |
|---|
| Frequency | 135.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O6 |
|---|
| Molecular Mass | 290.079 |
|---|
| SMILES | COc1cc(CC(=O)c2c(O)cc(O)cc2O)ccc1O |
|---|
| InChI Key | AUDKIJLPIXBZDL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | stilbenes |
|---|
| Subclass | stilbenes |
|---|
| Direct Parent | stilbenes |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacylphloroglucinols and derivativesalkyl aryl ethersalkyl-phenylketonesanisolesaryl alkyl ketonesbenzoyl derivativeshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesphenoxy compoundsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketonebenzoyl1-hydroxy-2-unsubstituted benzenoidmethoxyphenolalkyl aryl etherketonephloroglucinol derivativeorganic oxideacylphloroglucinol derivativebenzenetriol1-hydroxy-4-unsubstituted benzenoidmethoxybenzenephenylketonearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundalkyl-phenylketoneorganooxygen compoundaryl ketonestilbene |
|---|
