| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:34 UTC |
|---|
| Update Date | 2025-03-21 18:00:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00027976 |
|---|
| Frequency | 144.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H15N5O3S3 |
|---|
| Molecular Mass | 337.0337 |
|---|
| SMILES | CC(=O)Nc1nc(CSCCC(N)=NS(N)(=O)=O)cs1 |
|---|
| InChI Key | WGSLMNOOVUSXKE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | n-arylamides |
|---|
| Direct Parent | n-acetylarylamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2,4-disubstituted thiazolesacetamidesamidinesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkylthioethersheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganopnictogen compoundssecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | carbonyl groupn-acetylarylaminearomatic heteromonocyclic compoundamidineorganosulfur compoundcarboxylic acid derivativeorganic oxideorganopnictogen compoundorganoheterocyclic compoundacetamideazoleorganic sulfuric acid or derivativessulfenyl compoundazacycledialkylthioetherheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundthioether2,4-disubstituted 1,3-thiazolehydrocarbon derivativethiazoleorganooxygen compound |
|---|
