| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:34 UTC |
|---|
| Update Date | 2025-03-21 18:00:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00027991 |
|---|
| Frequency | 135.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20O7 |
|---|
| Molecular Mass | 312.1209 |
|---|
| SMILES | O=C(OC1CC(O)C(O)C(O)C1O)C(CO)c1ccccc1 |
|---|
| InChI Key | XAKHFVOIOKLCTJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | alcohols and polyols |
|---|
| Direct Parent | cyclohexanols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscyclitols and derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesprimary alcohols |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcyclohexanolcyclitol or derivativeshydroxy acidcyclic alcoholcarboxylic acid derivativearomatic homomonocyclic compoundbeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativescarboxylic acid esterhydrocarbon derivativebenzenoidprimary alcohol |
|---|
