| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:45:37 UTC |
|---|
| Update Date | 2025-03-21 18:00:34 UTC |
|---|
| HMDB ID | HMDB0130471 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028095 |
|---|
| Name | 2,4-dihydroxy-3-(sulfooxy)benzoic acid |
|---|
| Frequency | 134.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H6O8S |
|---|
| Molecular Mass | 249.9783 |
|---|
| SMILES | O=C(O)c1ccc(O)c(OS(=O)(=O)O)c1O |
|---|
| InChI Key | LGDWIQKNQQOLRV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzoic acidsbenzoyl derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundsphenoxy compoundsresorcinolssalicylic acidssulfuric acid monoestersvinylogous acids |
|---|
| Substituents | monocyclic benzene moietysulfuric acid monoestercarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidsalicylic acidcarboxylic acid derivativeresorcinolphenylsulfateorganic oxide1-carboxy-2-haloaromatic compoundbenzoic acidbenzoic acid or derivatives1-hydroxy-4-unsubstituted benzenoidhydroxybenzoic acidaromatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativessulfate-esterphenolhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esterorganooxygen compound |
|---|