Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-20 23:45:37 UTC |
---|
Update Date | 2025-03-21 18:00:34 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00028115 |
---|
Frequency | 134.3 |
---|
Structure | |
---|
Chemical Formula | C8H8O7S |
---|
Molecular Mass | 247.9991 |
---|
SMILES | O=C(OCOS(=O)(=O)O)c1ccccc1O |
---|
InChI Key | JOCDKSKXKWRBLU-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | benzenoids |
---|
Class | benzene and substituted derivatives |
---|
Subclass | benzoic acids and derivatives |
---|
Direct Parent | o-hydroxybenzoic acid esters |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl sulfatesbenzoyl derivativescarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganooxygen compoundssalicylic acid and derivativessulfuric acid monoestersvinylogous acids |
---|
Substituents | sulfuric acid monoesterbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxidealkyl sulfateorganic sulfuric acid or derivatives1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivativeso-hydroxybenzoic acid estercarboxylic acid estersulfate-esterphenolhydrocarbon derivativesulfuric acid esterorganooxygen compound |
---|