| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:45:37 UTC |
|---|
| Update Date | 2025-03-21 18:00:34 UTC |
|---|
| HMDB ID | HMDB0141330 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028125 |
|---|
| Name | 2-hydroxy-3-(3,4,5-trimethoxyphenyl)propanoic acid |
|---|
| Frequency | 134.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16O6 |
|---|
| Molecular Mass | 256.0947 |
|---|
| SMILES | COc1cc(CC(O)C(=O)O)cc(OC)c1OC |
|---|
| InChI Key | BNDLDFZEMAXWDK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalpha hydroxy acids and derivativesanisolescarbonyl compoundscarboxylic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundssecondary alcohols |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acid3-phenylpropanoic-acidalpha-hydroxy acidhydroxy acidalkyl aryl ethercarboxylic acid derivativemethoxybenzenearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|
