| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:39 UTC |
|---|
| Update Date | 2025-03-21 18:00:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028166 |
|---|
| Frequency | 134.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H14O7 |
|---|
| Molecular Mass | 210.074 |
|---|
| SMILES | COC(=O)C(O)C(O)C(O)C(O)CO |
|---|
| InChI Key | XKJLTJCYZRLXMM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty alcohols |
|---|
| Direct Parent | fatty alcohols |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundsfatty acid estershydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholaliphatic acyclic compoundcarbonyl groupmonosaccharidehydroxy acidcarboxylic acid derivativefatty acid esterbeta-hydroxy acidsaccharideorganic oxidemonocarboxylic acid or derivativesmethyl esterorganic oxygen compoundfatty alcoholcarboxylic acid estersecondary alcoholhydrocarbon derivativeprimary alcoholorganooxygen compound |
|---|