| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:39 UTC |
|---|
| Update Date | 2025-03-21 18:00:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028188 |
|---|
| Frequency | 139.8 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H10NO7P |
|---|
| Molecular Mass | 227.0195 |
|---|
| SMILES | CC(OP(=O)(O)O)C(=O)NCC(=O)O |
|---|
| InChI Key | DSCKOJMHOQIFLE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | acyl glycines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alpha amino acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphoethanolaminessecondary carboxylic acid amides |
|---|
| Substituents | aliphatic acyclic compoundcarbonyl groupcarboxylic acidphosphoethanolamineorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundcarboxamide groupn-acylglycinesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|