| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:40 UTC |
|---|
| Update Date | 2025-03-21 18:00:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028223 |
|---|
| Frequency | 133.7 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H32NO4+ |
|---|
| Molecular Mass | 302.2326 |
|---|
| SMILES | C[N+](C)(C)CCOC(=O)CCCCCCCCCC(=O)O |
|---|
| InChI Key | DZQAFYCPXWUEJE-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | quaternary ammonium salts |
|---|
| Direct Parent | acyl cholines |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | aminesamino fatty acidscarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesfatty acid estershydrocarbon derivativesmedium-chain fatty acidsmedium-chain hydroxy acids and derivativesorganic cationsorganic oxidesorganic saltsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidcarboxylic acid derivativemedium-chain hydroxy acidorganic oxideorganopnictogen compoundmedium-chain fatty acidorganic cationorganic salttetraalkylammonium saltamino fatty acidfatty acid esterorganic oxygen compoundcarboxylic acid esteracyl cholinedicarboxylic acid or derivativeshydrocarbon derivativeamineorganooxygen compound |
|---|