| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:43 UTC |
|---|
| Update Date | 2025-03-21 18:00:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028322 |
|---|
| Frequency | 133.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H15NO8 |
|---|
| Molecular Mass | 313.0798 |
|---|
| SMILES | O=C(CO)Nc1ccccc1OC1OC(C(=O)O)C(O)C1O |
|---|
| InChI Key | BRHYNWODTGSVNY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesn-arylamidesorganic oxidesorganopnictogen compoundsoxacyclic compoundsphenol ethersphenoxy compoundssecondary alcoholssecondary carboxylic acid amidestetrahydrofurans |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundmonosacchariden-arylamidecarboxylic acid derivativebeta-hydroxy acidsaccharideorganic oxideacetalorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundalcoholtetrahydrofuranhydroxy acidcarboxamide groupanilideoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
