| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:43 UTC |
|---|
| Update Date | 2025-03-21 18:00:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028328 |
|---|
| Frequency | 133.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H16ClN5O2 |
|---|
| Molecular Mass | 297.0993 |
|---|
| SMILES | N=C(NCCCC(=O)O)NC(=N)Nc1ccc(Cl)cc1 |
|---|
| InChI Key | QWCFZQVCPUDTNS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | guanidines |
|---|
| Direct Parent | 1-arylbiguanides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboximidamidescarboxylic acidschlorobenzenesgamma amino acids and derivativeshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganopnictogen compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidgamma amino acid or derivativesimineorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxideorganopnictogen compound1-arylbiguanidearyl chloridechlorobenzenecarboximidamidearyl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidhalobenzeneorganooxygen compound |
|---|
