| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:43 UTC |
|---|
| Update Date | 2025-03-21 18:00:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028346 |
|---|
| Frequency | 132.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O5 |
|---|
| Molecular Mass | 284.0685 |
|---|
| SMILES | Cc1ccc(-c2oc3cc(O)cc(O)c3c(=O)c2O)cc1 |
|---|
| InChI Key | NZYNOQJREPNPGV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavones |
|---|
| Direct Parent | flavonols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids3-hydroxyflavonoids5-hydroxyflavonoids7-hydroxyflavonoidschromonesflavonoidsheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganooxygen compoundsoxacyclic compoundspyranones and derivativestoluenesvinylogous acids |
|---|
| Substituents | 3-hydroxyflavonemonocyclic benzene moiety3-hydroxyflavonoid1-benzopyran1-hydroxy-2-unsubstituted benzenoidorganic oxidechromonearomatic heteropolycyclic compoundpyranoneorganoheterocyclic compoundbenzopyranheteroaromatic compound5-hydroxyflavonoid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidorganic oxygen compoundpyran7-hydroxyflavonoidhydrocarbon derivativebenzenoidtolueneorganooxygen compound |
|---|
