| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:45 UTC |
|---|
| Update Date | 2025-03-21 18:00:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028411 |
|---|
| Frequency | 132.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C3H2F4O5S |
|---|
| Molecular Mass | 225.9559 |
|---|
| SMILES | O=C(O)C(F)(F)C(F)(F)S(=O)(=O)O |
|---|
| InChI Key | NWMVQEZTZDXZDN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | organosulfonic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesalpha-halocarboxylic acidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganofluoridessulfonyls |
|---|
| Substituents | alpha-halocarboxylic acid or derivativesaliphatic acyclic compoundcarbonyl groupcarboxylic acidalkyl fluorideorganofluorideorganosulfonic acidalpha-halocarboxylic acidorganosulfur compoundcarboxylic acid derivativeorganohalogen compoundorganic oxidemonocarboxylic acid or derivativessulfonylorganic oxygen compoundalkyl halidehydrocarbon derivativeorganooxygen compound |
|---|
