| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:45 UTC |
|---|
| Update Date | 2025-03-21 18:00:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028417 |
|---|
| Frequency | 132.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N2O2 |
|---|
| Molecular Mass | 208.1212 |
|---|
| SMILES | CN(C)C(=O)C(N)Cc1ccc(O)cc1 |
|---|
| InChI Key | YHVJCWPOEZQLQY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | tyrosine and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenylalanine and derivativestertiary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouptyrosine or derivativesalpha-amino acid amide1-hydroxy-2-unsubstituted benzenoidcarboxamide grouparomatic homomonocyclic compoundorganic oxidephenylalanine or derivativesorganic oxygen compoundtertiary carboxylic acid amideorganonitrogen compoundalpha-amino acidorganopnictogen compoundphenolhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compoundamphetamine or derivatives |
|---|