| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:46 UTC |
|---|
| Update Date | 2025-03-21 18:00:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028434 |
|---|
| Frequency | 181.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H22N5O8P |
|---|
| Molecular Mass | 455.1206 |
|---|
| SMILES | Cc1cc2nc3c(=O)nc(N)nc-3n(CC(O)C(O)C(O)COP(=O)(O)O)c2cc1C |
|---|
| InChI Key | PVVXDHCUVKMJGR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidsdiazanaphthalenesheteroaromatic compoundshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidonesquinoxalinessecondary alcohols |
|---|
| Substituents | pyrimidonepyrimidineorganic oxidediazanaphthalenearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalcoholquinoxalinepterinazacycleheteroaromatic compoundorganic oxygen compoundphosphoric acid estermonoalkyl phosphatepyrazinesecondary alcoholhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundorganic phosphoric acid derivativeaminealkyl phosphateorganooxygen compound |
|---|