| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:48 UTC |
|---|
| Update Date | 2025-03-21 18:00:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028534 |
|---|
| Frequency | 131.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H9ClO3 |
|---|
| Molecular Mass | 200.024 |
|---|
| SMILES | CC(C(=O)O)c1ccc(O)c(Cl)c1 |
|---|
| InChI Key | WPHDDNANIJEQPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsaryl chloridescarbonyl compoundscarboxylic acidschlorobenzeneshalophenolshydrocarbon derivativesmonocarboxylic acids and derivativeso-chlorophenolsorganic oxidesorganochlorides |
|---|
| Substituents | aryl chloride2-chlorophenolchlorobenzenemonocyclic benzene moietycarbonyl groupcarboxylic acidorganochloride1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganohalogen compoundaryl halidearomatic homomonocyclic compound2-halophenolorganic oxidemonocarboxylic acid or derivativesorganic oxygen compound2-phenylpropanoic-acidphenolhydrocarbon derivativebenzenoidhalobenzeneorganooxygen compound |
|---|
