| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:45:50 UTC |
|---|
| Update Date | 2025-03-21 18:00:39 UTC |
|---|
| HMDB ID | HMDB0130470 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028595 |
|---|
| Name | 3,4,5-trihydroxy-6-(2,3,4-trihydroxybenzoyloxy)oxane-2-carboxylic acid |
|---|
| Frequency | 131.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14O11 |
|---|
| Molecular Mass | 346.0536 |
|---|
| SMILES | O=C(OC1OC(C(=O)O)C(O)C(O)C1O)c1ccc(O)c(O)c1O |
|---|
| InChI Key | XHZKWWAISIEEBC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids5-unsubstituted pyrrogallolsacetalsbenzoyl derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesoxacyclic compoundsoxanespyran carboxylic acidssalicylic acid and derivativessecondary alcoholsvinylogous acidsm-hydroxybenzoic acid esterso-hydroxybenzoic acid estersp-hydroxybenzoic acid alkyl esters |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundp-hydroxybenzoic acid esterbenzoylo-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidebenzoate estercarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetal5-unsubstituted pyrrogalloloxanem-hydroxybenzoic acid esterorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativespyrogallol derivativebenzenetriolbenzoic acid or derivativeshydroxy acid1-hydroxy-4-unsubstituted benzenoidp-hydroxybenzoic acid alkyl esteroxacyclevinylogous acidsalicylic acid or derivativeso-hydroxybenzoic acid esterpyrancarboxylic acid estersecondary alcoholdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoid |
|---|