| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:51 UTC |
|---|
| Update Date | 2025-03-21 18:00:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028629 |
|---|
| Frequency | 131.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H15NO3 |
|---|
| Molecular Mass | 269.1052 |
|---|
| SMILES | CC(C(=O)O)c1cccc(C(=O)c2ccccc2N)c1 |
|---|
| InChI Key | MIGLXSQGKOZWMU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amino acidsaryl ketonesaryl-phenylketonesbenzoyl derivativescarboxylic acidsdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenylpropanoic acidsprimary aminesvinylogous amides |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acidamino acid or derivativesamino acidbenzoylcarboxylic acid derivativebenzophenoneketoneorganic oxide2-phenylpropanoic-acidorganonitrogen compoundorganopnictogen compoundvinylogous amidearyl-phenylketonearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compoundaryl ketone |
|---|