Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:45:52 UTC |
---|
Update Date | 2025-03-21 18:00:40 UTC |
---|
HMDB ID | HMDB0140952 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00028692 |
---|
Name | 3,4,5-trihydroxy-6-[(2-oxo-2H-chromen-8-yl)oxy]oxane-2-carboxylic acid |
---|
Frequency | 131.0 |
---|
Structure | |
---|
Chemical Formula | C15H14O9 |
---|
Molecular Mass | 338.0638 |
---|
SMILES | O=C(O)C1OC(Oc2cccc3ccc(=O)oc23)C(O)C(O)C1O |
---|
InChI Key | UGCXHNMVZFRPBN-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | coumarins and derivatives |
---|
Subclass | coumarin glycosides |
---|
Direct Parent | coumarin glycosides |
---|
Geometric Descriptor | aromatic heteropolycyclic compounds |
---|
Alternative Parents | 1-benzopyransacetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativesheteroaromatic compoundshydrocarbon derivativeslactonesmonocarboxylic acids and derivativesmonosaccharideso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenol etherspyran carboxylic acidspyranones and derivativessecondary alcohols |
---|
Substituents | phenol ethercoumarin-8-o-glycosidecarbonyl groupcarboxylic acidglucuronic acid or derivativescoumarin o-glycoside1-benzopyrano-glucuronidemonosaccharidecarboxylic acid derivativepyran carboxylic acidlactone1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalaromatic heteropolycyclic compoundpyranoneoxaneorganoheterocyclic compoundalcoholbenzopyranpyran carboxylic acid or derivativesheteroaromatic compoundhydroxy acidoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundpyransecondary alcoholhydrocarbon derivativebenzenoidorganooxygen compound |
---|