| Record Information |
|---|
| HMDB Status | quantified |
|---|
| Creation Date | 2024-02-20 23:45:52 UTC |
|---|
| Update Date | 2025-03-21 18:00:40 UTC |
|---|
| HMDB ID | HMDB0002172 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028694 |
|---|
| Name | N1,N12-Diacetylspermine |
|---|
| Frequency | 131.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H30N4O2 |
|---|
| Molecular Mass | 286.2369 |
|---|
| SMILES | CC(=O)NCCCNCCCCNCCCNC(C)=O |
|---|
| InChI Key | NPDTUDWGJMBVEP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | carboxylic acid derivatives |
|---|
| Direct Parent | acetamides |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | amino acids and derivativescarbonyl compoundscarboxylic acids and derivativesdialkylamineshydrocarbon derivativesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amides |
|---|
| Substituents | aliphatic acyclic compoundsecondary aliphatic aminecarbonyl groupamino acid or derivativessecondary aminesecondary carboxylic acid amideorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundacetamideorganooxygen compoundamine |
|---|
