Record Information |
---|
HMDB Status | predicted |
---|
Creation Date | 2024-02-20 23:45:56 UTC |
---|
Update Date | 2025-03-21 18:00:41 UTC |
---|
HMDB ID | HMDB0128186 |
---|
Metabolite Identification |
---|
DeepMet ID | DMID00028839 |
---|
Name | 2-hydroxy-3-(2,4,5-trihydroxyphenyl)propanoic acid |
---|
Frequency | 130.2 |
---|
Structure | |
---|
Chemical Formula | C9H10O6 |
---|
Molecular Mass | 214.0477 |
---|
SMILES | O=C(O)C(O)Cc1cc(O)c(O)cc1O |
---|
InChI Key | UKGGYECCVQFMLC-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | phenylpropanoids and polyketides |
---|
Class | phenylpropanoic acids |
---|
Subclass | phenylpropanoic acids |
---|
Direct Parent | phenylpropanoic acids |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha hydroxy acids and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
---|
Substituents | alcoholmonocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidalpha-hydroxy acid1-hydroxy-2-unsubstituted benzenoidhydroxy acidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
---|