| Record Information |
|---|
| HMDB Status | predicted |
|---|
| Creation Date | 2024-02-20 23:45:56 UTC |
|---|
| Update Date | 2025-03-21 18:00:41 UTC |
|---|
| HMDB ID | HMDB0128186 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028839 |
|---|
| Name | 2-hydroxy-3-(2,4,5-trihydroxyphenyl)propanoic acid |
|---|
| Frequency | 130.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O6 |
|---|
| Molecular Mass | 214.0477 |
|---|
| SMILES | O=C(O)C(O)Cc1cc(O)c(O)cc1O |
|---|
| InChI Key | UKGGYECCVQFMLC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalpha hydroxy acids and derivativesbenzene and substituted derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidessecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietycarbonyl groupcarboxylic acid3-phenylpropanoic-acidalpha-hydroxy acid1-hydroxy-2-unsubstituted benzenoidhydroxy acidcarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholphenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
