| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:57 UTC |
|---|
| Update Date | 2025-03-21 18:00:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028877 |
|---|
| Frequency | 130.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H18O11 |
|---|
| Molecular Mass | 434.0849 |
|---|
| SMILES | O=C1CC(c2ccc(OC3OC(O)C(O)C(C(=O)O)O3)cc2)Oc2cc(O)cc(O)c21 |
|---|
| InChI Key | FOXCAAVXYHGALX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavans |
|---|
| Direct Parent | flavanones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanes1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoids5-hydroxyflavonoids7-hydroxyflavonoidsalkyl aryl ethersaryl alkyl ketonesbeta hydroxy acids and derivativescarboxylic acid orthoesterscarboxylic acidschromoneshemiacetalshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesortho estersoxacyclic compoundsphenol ethersphenoxy compoundssecondary alcoholsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaryl alkyl ketone1-benzopyranortho esterflavanone1-hydroxy-2-unsubstituted benzenoidcarboxylic acid orthoesteralkyl aryl ethercarboxylic acid derivativeketonebeta-hydroxy acidorganic oxidechromonearomatic heteropolycyclic compoundchromanehemiacetalorthocarboxylic acid derivativeorganoheterocyclic compoundalcoholbenzopyran5-hydroxyflavonoidhydroxy acid1-hydroxy-4-unsubstituted benzenoidoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compound7-hydroxyflavonoidsecondary alcoholhydrocarbon derivativebenzenoidphenoxy compoundmeta-dioxaneorganooxygen compoundaryl ketone |
|---|
