| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:59 UTC |
|---|
| Update Date | 2025-03-21 18:00:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028946 |
|---|
| Frequency | 129.6 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H10N2O4 |
|---|
| Molecular Mass | 318.0641 |
|---|
| SMILES | Cc1c(=O)c(=O)c2c3c(=O)c(=O)c(C)c4[nH]cc(c5c[nH]c1c52)c43 |
|---|
| InChI Key | NIWJRJBBSLLQFL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindolequinonesindolesisoindolesnaphthalenesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrolesquinonesvinylogous amides |
|---|
| Substituents | vinylogous amidephenanthreneindolequinoneazacycleindoleisoindoleheteroaromatic compoundindole or derivativescyclic ketoneorganic oxidenaphthaleneorganic oxygen compoundaromatic heteropolycyclic compoundisoindole or derivativespyrroleorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganoheterocyclic compoundorganooxygen compoundquinone |
|---|
