| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:45:59 UTC |
|---|
| Update Date | 2025-03-21 18:00:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00028960 |
|---|
| Frequency | 129.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H7O8P |
|---|
| Molecular Mass | 213.9879 |
|---|
| SMILES | O=C1OC(OP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | YLGINTZBEZSECD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolscarbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesoxacyclic compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | alcoholcarbonyl grouptetrahydrofuranmonosaccharidecarboxylic acid derivativegamma butyrolactonelactoneoxacyclesaccharideorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphatecarboxylic acid esteraliphatic heteromonocyclic compoundsecondary alcoholhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound1,2-diol |
|---|