| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:06 UTC |
|---|
| Update Date | 2025-03-21 18:00:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00029212 |
|---|
| Frequency | 128.2 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H10O5 |
|---|
| Molecular Mass | 258.0528 |
|---|
| SMILES | O=C(O)c1ccccc1C(=O)Oc1ccc(O)cc1 |
|---|
| InChI Key | DDKWZUMWCMLKPW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | depsides and depsidones |
|---|
| Subclass | depsides and depsidones |
|---|
| Direct Parent | depsides and depsidones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoidsbenzoic acid estersbenzoic acidsbenzoyl derivativescarboxylic acid estersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsphenol estersphenoxy compounds |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidbenzoyl1-hydroxy-2-unsubstituted benzenoidbenzoic acid or derivativesbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxideorganic oxygen compoundcarboxylic acid esterphenol esterdicarboxylic acid or derivativesphenolhydrocarbon derivativebenzenoid1-carboxy-2-haloaromatic compoundbenzoic acidphenoxy compoundorganooxygen compounddepside backbone |
|---|
