| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:06 UTC |
|---|
| Update Date | 2025-03-21 18:00:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00029226 |
|---|
| Frequency | 128.1 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18O3 |
|---|
| Molecular Mass | 270.1256 |
|---|
| SMILES | Cc1c(O)cc2c(c1C)OC(c1ccc(O)cc1)CC2 |
|---|
| InChI Key | ZYTSOVCJMDUXGW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | hydroxyflavonoids |
|---|
| Direct Parent | 6-hydroxyflavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-benzopyrans1-hydroxy-2-unsubstituted benzenoids4'-hydroxyflavonoidsalkyl aryl ethersbenzene and substituted derivativesflavanshydrocarbon derivativesoxacyclic compounds |
|---|
| Substituents | monocyclic benzene moietyetherbenzopyran1-benzopyranflavan6-hydroxyflavonoid1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxygen compoundaromatic heteropolycyclic compoundchromane4'-hydroxyflavonoidphenolhydrocarbon derivativebenzenoidorganoheterocyclic compoundorganooxygen compound |
|---|
