| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:06 UTC |
|---|
| Update Date | 2025-03-21 18:00:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00029240 |
|---|
| Frequency | 128.0 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H15N2O9P |
|---|
| Molecular Mass | 302.0515 |
|---|
| SMILES | NC(=O)NC1C(OP(=O)(O)O)OC(CO)C(O)C1O |
|---|
| InChI Key | GAMLWSMJMHHTNL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundshydrocarbon derivativesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarbonic acid derivativemonosaccharideoxacyclesaccharideorganic oxideorganic oxygen compoundmonoalkyl phosphatealiphatic heteromonocyclic compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|
