| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:07 UTC |
|---|
| Update Date | 2025-03-21 18:00:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00029265 |
|---|
| Frequency | 127.9 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H18O8 |
|---|
| Molecular Mass | 410.1002 |
|---|
| SMILES | O=C(O)C1OC(Oc2ccc3ccc4ccc(O)c5ccc2c3c45)C(O)C(O)C1O |
|---|
| InChI Key | ILJWIRPBXIVNGD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | pyrenes |
|---|
| Subclass | pyrenes |
|---|
| Direct Parent | pyrenes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesnaphthols and derivativeso-glucuronidesorganic oxidesoxacyclic compoundsoxanesphenanthrolsphenol etherspyran carboxylic acidssecondary alcohols |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidglucuronic acid or derivativeso-glucuronide1-hydroxy-2-unsubstituted benzenoidmonosaccharidecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalaromatic heteropolycyclic compoundoxane2-naphtholorganoheterocyclic compoundalcoholphenanthrenepyran carboxylic acid or derivativesphenanthrolhydroxy acidoxacyclepyrenemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compoundpyransecondary alcoholhydrocarbon derivative1-naphtholorganooxygen compound |
|---|