| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-20 23:46:10 UTC |
|---|
| Update Date | 2025-03-21 18:00:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID00029367 |
|---|
| Frequency | 127.3 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H9O9P |
|---|
| Molecular Mass | 255.9984 |
|---|
| SMILES | O=C1OC(COP(=O)(O)O)C(O)C(O)=C1O |
|---|
| InChI Key | WLJKDCFDIBWECN-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | dihydropyranones |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundsenoate estershydrocarbon derivativeslactonesmonoalkyl phosphatesmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundssecondary alcoholsvinylogous acids |
|---|
| Substituents | carbonyl groupdihydropyranonecarboxylic acid derivativelactonealpha,beta-unsaturated carboxylic esterorganic oxidealiphatic heteromonocyclic compoundenoate esteralcoholoxacyclevinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundphosphoric acid estermonoalkyl phosphatecarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic phosphoric acid derivativealkyl phosphateorganooxygen compound |
|---|
